About 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole
3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole (PubChem CID 150600885) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole |
| PubChem CID | 150600885 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole |
| SMILES | CC1(COc2nsnc2OC23CCC(CN2)C3)CC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-12(4-5-12)8-17-10-11(16-19-15-10)18-13-3-2-9(6-13)7-14-13/h9,14H,2-8H2,1H3 |
| InChIKey | IRVUXNJYOHPWEQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole?
The IUPAC name of 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole (CID 150600885) is 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole.
What is the SMILES notation for 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole?
The canonical SMILES for 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole is CC1(COc2nsnc2OC23CCC(CN2)C3)CC1.
What is the InChIKey of 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole?
The InChIKey is IRVUXNJYOHPWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-12(4-5-12)8-17-10-11(16-19-15-10)18-13-3-2-9(6-13)7-14-13/h9,14H,2-8H2,1H3.
What are the key properties of 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole?
3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole has a molecular weight of 281.38 g/mol, XLogP of 2.20, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-azabicyclo[2.2.1]heptan-1-yloxy)-4-[(1-methylcyclopropyl)methoxy]-1,2,5-thiadiazole is sourced from PubChem (CID 150600885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).