About 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane
9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane (PubChem CID 150602122) has the molecular formula C27H54O3
and a molecular weight of 426.73 g/mol. Its IUPAC name is 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane.
Molecular Properties
| Compound Name | 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane |
| PubChem CID | 150602122 |
| Molecular Formula | C27H54O3 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.41 |
| IUPAC Name | 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane |
| SMILES | CC=COCCCCCCCCC(CCCCCC(C)CC)C(C)(OCC)OCC |
| InChI | InChI=1S/C27H54O3/c1-7-23-28-24-19-14-12-11-13-17-21-26(27(6,29-9-3)30-10-4)22-18-15-16-20-25(5)8-2/h7,23,25-26H,8-22,24H2,1-6H3 |
| InChIKey | ISCAZQFMJGYHAX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane?
The IUPAC name of 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane (CID 150602122) is 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane.
What is the SMILES notation for 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane?
The canonical SMILES for 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane is CC=COCCCCCCCCC(CCCCCC(C)CC)C(C)(OCC)OCC.
What is the InChIKey of 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane?
The InChIKey is ISCAZQFMJGYHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H54O3/c1-7-23-28-24-19-14-12-11-13-17-21-26(27(6,29-9-3)30-10-4)22-18-15-16-20-25(5)8-2/h7,23,25-26H,8-22,24H2,1-6H3.
What are the key properties of 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane?
9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane has a molecular weight of 426.73 g/mol, XLogP of 8.67, 22 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,1-diethoxyethyl)-15-methyl-1-prop-1-enoxyheptadecane is sourced from PubChem (CID 150602122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).