About 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid
2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid (PubChem CID 150602340) has the molecular formula C13H12BrCl2N5O2S
and a molecular weight of 453.15 g/mol. Its IUPAC name is 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid.
Molecular Properties
| Compound Name | 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid |
| PubChem CID | 150602340 |
| Molecular Formula | C13H12BrCl2N5O2S |
| Molecular Weight | 453.15 g/mol |
| Exact Mass | 450.93 |
| IUPAC Name | 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid |
| SMILES | Cc1nc(NCCNC(=O)O)c(Br)nc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C13H12BrCl2N5O2S/c1-6-12(24-7-2-3-17-10(16)8(7)15)21-9(14)11(20-6)18-4-5-19-13(22)23/h2-3,19H,4-5H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | ISDFOUZWMRYJFC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid?
The IUPAC name of 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid (CID 150602340) is 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid.
What is the SMILES notation for 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid?
The canonical SMILES for 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid is Cc1nc(NCCNC(=O)O)c(Br)nc1Sc1ccnc(Cl)c1Cl.
What is the InChIKey of 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid?
The InChIKey is ISDFOUZWMRYJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrCl2N5O2S/c1-6-12(24-7-2-3-17-10(16)8(7)15)21-9(14)11(20-6)18-4-5-19-13(22)23/h2-3,19H,4-5H2,1H3,(H,18,20)(H,22,23).
What are the key properties of 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid?
2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid has a molecular weight of 453.15 g/mol, XLogP of 4.08, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]amino]ethylcarbamic acid is sourced from PubChem (CID 150602340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).