C43H48N10OS2 — CID 150607344
2,4-bis[4-[[2-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazin-1-yl]pentan-3-one (PubChem CID 150607344) has the molecular formula C43H48N10OS2 and a molecular weight of 785.06 g/mol. Its IUPAC name is 2,4-bis[4-[[2-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-[[2-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 150607344 |
| Molecular Formula | C43H48N10OS2 |
| Molecular Weight | 785.06 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | 2,4-bis[4-[[2-[(5-phenyl-1,3-thiazol-2-yl)amino]-4-pyridinyl]methyl]piperazin-1-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)N1CCN(Cc2ccnc(Nc3ncc(-c4ccccc4)s3)c2)CC1)N1CCN(Cc2ccnc(Nc3ncc(-c4ccccc4)s3)c2)CC1 |
| InChI | InChI=1S/C43H48N10OS2/c1-31(52-21-17-50(18-22-52)29-33-13-15-44-39(25-33)48-42-46-27-37(55-42)35-9-5-3-6-10-35)41(54)32(2)53-23-19-51(20-24-53)30-34-14-16-45-40(26-34)49-43-47-28-38(56-43)36-11-7-4-8-12-36/h3-16,25-28,31-32H,17-24,29-30H2,1-2H3,(H,44,46,48)(H,45,47,49) |
| InChIKey | ITDPTWHRYPLXTF-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.06 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |