About methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate
methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate (PubChem CID 15060741) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate |
| PubChem CID | 15060741 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCCNC1=O |
| InChI | InChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-8-6(5)9/h3H,2,4H2,1H3,(H,8,9) |
| InChIKey | NEOGBNRMETYSBW-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate?
The IUPAC name of methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate (CID 15060741) is methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate.
What is the SMILES notation for methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate?
The canonical SMILES for methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate is COC(=O)C1=CCCNC1=O.
What is the InChIKey of methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate?
The InChIKey is NEOGBNRMETYSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-11-7(10)5-3-2-4-8-6(5)9/h3H,2,4H2,1H3,(H,8,9).
What are the key properties of methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate?
methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate has a molecular weight of 155.15 g/mol, XLogP of -0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate is sourced from PubChem (CID 15060741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).