C23H19ClF2N6O2 — CID 150607482
methyl (2R)-4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridin-3-yl]piperazine-2-carboxylate (PubChem CID 150607482) has the molecular formula C23H19ClF2N6O2 and a molecular weight of 484.89 g/mol. Its IUPAC name is methyl (2R)-4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridin-3-yl]piperazine-2-carboxylate.
| Compound Name | methyl (2R)-4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridin-3-yl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 150607482 |
| Molecular Formula | C23H19ClF2N6O2 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | methyl (2R)-4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridin-3-yl]piperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(c2cnc3ccc(-c4cn[nH]c4-c4cc(Cl)c(F)cc4F)nc3c2)CCN1 |
| InChI | InChI=1S/C23H19ClF2N6O2/c1-34-23(33)21-11-32(5-4-27-21)12-6-20-19(28-9-12)3-2-18(30-20)14-10-29-31-22(14)13-7-15(24)17(26)8-16(13)25/h2-3,6-10,21,27H,4-5,11H2,1H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | ITEJXQZPFCUCOO-OAQYLSRUSA-N |
| XLogP | 3.57 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|