C27H31BFN5O9 — CID 150607673
(3R)-3-[[2-[4-(3-aminopropoxy)-2-fluorophenyl]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 150607673) has the molecular formula C27H31BFN5O9 and a molecular weight of 599.38 g/mol. Its IUPAC name is (3R)-3-[[2-[4-(3-aminopropoxy)-2-fluorophenyl]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-[4-(3-aminopropoxy)-2-fluorophenyl]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 150607673 |
| Molecular Formula | C27H31BFN5O9 |
| Molecular Weight | 599.38 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | (3R)-3-[[2-[4-(3-aminopropoxy)-2-fluorophenyl]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2ccc(OCCCN)cc2F)C(=O)C1=O |
| InChI | InChI=1S/C27H31BFN5O9/c1-2-33-10-11-34(25(37)24(33)36)27(40)32-21(17-8-7-16(14-19(17)29)42-12-4-9-30)23(35)31-20-13-15-5-3-6-18(26(38)39)22(15)43-28(20)41/h3,5-8,14,20-21,41H,2,4,9-13,30H2,1H3,(H,31,35)(H,32,40)(H,38,39)/t20-,21?/m0/s1 |
| InChIKey | ITFKPZWQMCQFDZ-BGERDNNASA-N |
| XLogP | -0.17 |
| TPSA | 200.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|