About [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone
[1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone (PubChem CID 150608264) has the molecular formula C13H11BrClN3O2
and a molecular weight of 356.61 g/mol. Its IUPAC name is [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone.
Molecular Properties
| Compound Name | [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone |
| PubChem CID | 150608264 |
| Molecular Formula | C13H11BrClN3O2 |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone |
| SMILES | CC1NCCN(c2nc3cc(Cl)cc(Br)c3o2)C1=C=O |
| InChI | InChI=1S/C13H11BrClN3O2/c1-7-11(6-19)18(3-2-16-7)13-17-10-5-8(15)4-9(14)12(10)20-13/h4-5,7,16H,2-3H2,1H3 |
| InChIKey | ITINFMZVTMUZEZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone?
The IUPAC name of [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone (CID 150608264) is [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone.
What is the SMILES notation for [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone?
The canonical SMILES for [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone is CC1NCCN(c2nc3cc(Cl)cc(Br)c3o2)C1=C=O.
What is the InChIKey of [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone?
The InChIKey is ITINFMZVTMUZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrClN3O2/c1-7-11(6-19)18(3-2-16-7)13-17-10-5-8(15)4-9(14)12(10)20-13/h4-5,7,16H,2-3H2,1H3.
What are the key properties of [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone?
[1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone has a molecular weight of 356.61 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(7-bromo-5-chloro-1,3-benzoxazol-2-yl)-3-methylpiperazin-2-ylidene]methanone is sourced from PubChem (CID 150608264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).