About [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate
[(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate (PubChem CID 150610766) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate |
| PubChem CID | 150610766 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate |
| SMILES | CCC[C@@H](COC(=O)C1CNC(=O)C1)C(N)=O |
| InChI | InChI=1S/C11H18N2O4/c1-2-3-7(10(12)15)6-17-11(16)8-4-9(14)13-5-8/h7-8H,2-6H2,1H3,(H2,12,15)(H,13,14)/t7-,8?/m0/s1 |
| InChIKey | ITVNGPKZNHBDPO-JAMMHHFISA-N |
| XLogP | -0.43 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate?
The IUPAC name of [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate (CID 150610766) is [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate.
What is the SMILES notation for [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate?
The canonical SMILES for [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate is CCC[C@@H](COC(=O)C1CNC(=O)C1)C(N)=O.
What is the InChIKey of [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate?
The InChIKey is ITVNGPKZNHBDPO-JAMMHHFISA-N. The full InChI is InChI=1S/C11H18N2O4/c1-2-3-7(10(12)15)6-17-11(16)8-4-9(14)13-5-8/h7-8H,2-6H2,1H3,(H2,12,15)(H,13,14)/t7-,8?/m0/s1.
What are the key properties of [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate?
[(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate has a molecular weight of 242.27 g/mol, XLogP of -0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-carbamoylpentyl] 5-oxopyrrolidine-3-carboxylate is sourced from PubChem (CID 150610766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).