C15H9N3O3S — CID 150611193
(5R,6Z)-7-oxo-6-(quinoxalin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 150611193) has the molecular formula C15H9N3O3S and a molecular weight of 311.32 g/mol. Its IUPAC name is (5R,6Z)-7-oxo-6-(quinoxalin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6Z)-7-oxo-6-(quinoxalin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 150611193 |
| Molecular Formula | C15H9N3O3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | (5R,6Z)-7-oxo-6-(quinoxalin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=CS[C@@H]2/C(=C\c3cnc4ccccc4n3)C(=O)N12 |
| InChI | InChI=1S/C15H9N3O3S/c19-13-9(14-18(13)12(7-22-14)15(20)21)5-8-6-16-10-3-1-2-4-11(10)17-8/h1-7,14H,(H,20,21)/b9-5-/t14-/m1/s1 |
| InChIKey | ITXQOBKWMPSSEC-VYLZPFMQSA-N |
| XLogP | 1.85 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|