About 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione
6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione (PubChem CID 15061180) has the molecular formula C14H14O5
and a molecular weight of 262.26 g/mol. Its IUPAC name is 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione |
| PubChem CID | 15061180 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione |
| SMILES | CCc1c(OC)cc2c(c1O)C(=O)C=C(OC)C2=O |
| InChI | InChI=1S/C14H14O5/c1-4-7-10(18-2)5-8-12(14(7)17)9(15)6-11(19-3)13(8)16/h5-6,17H,4H2,1-3H3 |
| InChIKey | KRSHMRFACGPISX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione?
The IUPAC name of 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione (CID 15061180) is 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione.
What is the SMILES notation for 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione?
The canonical SMILES for 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is CCc1c(OC)cc2c(c1O)C(=O)C=C(OC)C2=O.
What is the InChIKey of 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione?
The InChIKey is KRSHMRFACGPISX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5/c1-4-7-10(18-2)5-8-12(14(7)17)9(15)6-11(19-3)13(8)16/h5-6,17H,4H2,1-3H3.
What are the key properties of 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione?
6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione has a molecular weight of 262.26 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is sourced from PubChem (CID 15061180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).