About [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate
[(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate (PubChem CID 150613204) has the molecular formula C18H25N3O2
and a molecular weight of 315.42 g/mol. Its IUPAC name is [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate.
Molecular Properties
| Compound Name | [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate |
| PubChem CID | 150613204 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate |
| SMILES | CC(=O)OCNc1c(C2CCCCC2)nc2cc(C)cc(C)n12 |
| InChI | InChI=1S/C18H25N3O2/c1-12-9-13(2)21-16(10-12)20-17(15-7-5-4-6-8-15)18(21)19-11-23-14(3)22/h9-10,15,19H,4-8,11H2,1-3H3 |
| InChIKey | IUIQEKMWPXOSFD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate?
The IUPAC name of [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate (CID 150613204) is [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate.
What is the SMILES notation for [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate?
The canonical SMILES for [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate is CC(=O)OCNc1c(C2CCCCC2)nc2cc(C)cc(C)n12.
What is the InChIKey of [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate?
The InChIKey is IUIQEKMWPXOSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O2/c1-12-9-13(2)21-16(10-12)20-17(15-7-5-4-6-8-15)18(21)19-11-23-14(3)22/h9-10,15,19H,4-8,11H2,1-3H3.
What are the key properties of [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate?
[(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate has a molecular weight of 315.42 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-cyclohexyl-5,7-dimethylimidazo[1,2-a]pyridin-3-yl)amino]methyl acetate is sourced from PubChem (CID 150613204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).