C27H24ClNO5 — CID 15061334
(2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) benzoate chloride (PubChem CID 15061334) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is (2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) benzoate chloride.
| Compound Name | (2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) benzoate chloride |
|---|---|
| PubChem CID | 15061334 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | (2,3,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-9-yl) benzoate chloride |
| SMILES | COc1cc2c(cc1OC)-c1cc3ccc(OC)c(OC(=O)c4ccccc4)c3c[n+]1CC2.[Cl-] |
| InChI | InChI=1S/C27H24NO5.ClH/c1-30-23-10-9-18-13-22-20-15-25(32-3)24(31-2)14-19(20)11-12-28(22)16-21(18)26(23)33-27(29)17-7-5-4-6-8-17;/h4-10,13-16H,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XSQDDKLGPSBMTR-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|