C21H21NO5 — CID 15061351
(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) acetate (PubChem CID 15061351) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) acetate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) acetate |
|---|---|
| PubChem CID | 15061351 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) acetate |
| SMILES | COc1ccc2c(c1OC(C)=O)CN1CCc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C21H21NO5/c1-12(23)27-21-16-10-22-6-5-14-8-19-20(26-11-25-19)9-15(14)17(22)7-13(16)3-4-18(21)24-2/h3-4,8-9,17H,5-7,10-11H2,1-2H3 |
| InChIKey | GLRJJXPRWYHFGP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|