About CID 150616662
CID 150616662 (PubChem CID 150616662) has the molecular formula C37H36N2O4Si
and a molecular weight of 600.79 g/mol.
Molecular Properties
| Compound Name | CID 150616662 |
| PubChem CID | 150616662 |
| Molecular Formula | C37H36N2O4Si |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | — |
| SMILES | COc1nc(-c2cccc3c2OCCO3)ccc1Nc1ccc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H36N2O4Si/c1-36(2,3)44-43-37(26-12-7-5-8-13-26,27-14-9-6-10-15-27)28-18-20-29(21-19-28)38-32-23-22-31(39-35(32)40-4)30-16-11-17-33-34(30)42-25-24-41-33/h5-23,38H,24-25H2,1-4H3 |
| InChIKey | WUFVMXZHSINAIZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 150616662 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150616662?
The IUPAC name of CID 150616662 (CID 150616662) is not available.
What is the SMILES notation for CID 150616662?
The canonical SMILES for CID 150616662 is COc1nc(-c2cccc3c2OCCO3)ccc1Nc1ccc(C(O[Si]C(C)(C)C)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 150616662?
The InChIKey is WUFVMXZHSINAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H36N2O4Si/c1-36(2,3)44-43-37(26-12-7-5-8-13-26,27-14-9-6-10-15-27)28-18-20-29(21-19-28)38-32-23-22-31(39-35(32)40-4)30-16-11-17-33-34(30)42-25-24-41-33/h5-23,38H,24-25H2,1-4H3.
What are the key properties of CID 150616662?
CID 150616662 has a molecular weight of 600.79 g/mol, XLogP of 8.42, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150616662 is sourced from PubChem (CID 150616662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).