C12H8F12N2O2 — CID 15061693
3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,10-diisocyanato-decane (PubChem CID 15061693) has the molecular formula C12H8F12N2O2 and a molecular weight of 440.18 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diisocyanatodecane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,10-diisocyanato-decane |
|---|---|
| PubChem CID | 15061693 |
| Molecular Formula | C12H8F12N2O2 |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diisocyanatodecane |
| SMILES | C(CN=C=O)C(C(C(C(C(C(CCN=C=O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | InChI=1S/C12H8F12N2O2/c13-7(14,1-3-25-5-27)9(17,18)11(21,22)12(23,24)10(19,20)8(15,16)2-4-26-6-28/h1-4H2 |
| InChIKey | QFBZSTRKAXTDMJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | 595 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|