C14H8F16N2O2 — CID 15061694
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Hexadecafluoro-1,12-diisocyanatododecane (PubChem CID 15061694) has the molecular formula C14H8F16N2O2 and a molecular weight of 540.20 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diisocyanatododecane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Hexadecafluoro-1,12-diisocyanatododecane |
|---|---|
| PubChem CID | 15061694 |
| Molecular Formula | C14H8F16N2O2 |
| Molecular Weight | 540.20 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diisocyanatododecane |
| SMILES | C(CN=C=O)C(C(C(C(C(C(C(C(CCN=C=O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | InChI=1S/C14H8F16N2O2/c15-7(16,1-3-31-5-33)9(19,20)11(23,24)13(27,28)14(29,30)12(25,26)10(21,22)8(17,18)2-4-32-6-34/h1-4H2 |
| InChIKey | VTABSFVPBBZSMU-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | 760 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.20 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|