C20H22O2 — CID 150618928
3-(2,2-diphenylethyl)-5-ethyloxolan-2-one (PubChem CID 150618928) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-(2,2-diphenylethyl)-5-ethyloxolan-2-one.
| Compound Name | 3-(2,2-diphenylethyl)-5-ethyloxolan-2-one |
|---|---|
| PubChem CID | 150618928 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-(2,2-diphenylethyl)-5-ethyloxolan-2-one |
| SMILES | CCC1CC(CC(c2ccccc2)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H22O2/c1-2-18-13-17(20(21)22-18)14-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3 |
| InChIKey | IVMFUAJVBXCZEF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |