C19H23N — CID 15061906
N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 15061906) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 15061906 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | c1ccc(CCCNC2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H23N/c1-2-7-16(8-3-1)9-6-14-20-19-13-12-17-10-4-5-11-18(17)15-19/h1-5,7-8,10-11,19-20H,6,9,12-15H2 |
| InChIKey | CEMUKLXXZBFFNQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|