C20H15F3N6O2 — CID 150621923
2-[3-[5-amino-6-(2-pyrimidin-5-ylethynyl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide (PubChem CID 150621923) has the molecular formula C20H15F3N6O2 and a molecular weight of 428.37 g/mol. Its IUPAC name is 2-[3-[5-amino-6-(2-pyrimidin-5-ylethynyl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide.
| Compound Name | 2-[3-[5-amino-6-(2-pyrimidin-5-ylethynyl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 150621923 |
| Molecular Formula | C20H15F3N6O2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[3-[5-amino-6-(2-pyrimidin-5-ylethynyl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide |
| SMILES | Cc1ccc(C(O)(C(N)=O)C(F)(F)F)cc1-c1cnc(N)c(C#Cc2cncnc2)n1 |
| InChI | InChI=1S/C20H15F3N6O2/c1-11-2-4-13(19(31,18(25)30)20(21,22)23)6-14(11)16-9-28-17(24)15(29-16)5-3-12-7-26-10-27-8-12/h2,4,6-10,31H,1H3,(H2,24,28)(H2,25,30) |
| InChIKey | IWBXVTNOQYESNT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|