About [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium
[amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium (PubChem CID 150622976) has the molecular formula C22H19N4O2+
and a molecular weight of 371.42 g/mol. Its IUPAC name is [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium.
Molecular Properties
| Compound Name | [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium |
| PubChem CID | 150622976 |
| Molecular Formula | C22H19N4O2+ |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1ccc2cc(NC(=O)Cc3cccc(-c4cnoc4)c3)ccc2c1 |
| InChI | InChI=1S/C22H18N4O2/c23-22(24)18-5-4-17-11-20(7-6-16(17)10-18)26-21(27)9-14-2-1-3-15(8-14)19-12-25-28-13-19/h1-8,10-13H,9H2,(H3,23,24)(H,26,27)/p+1 |
| InChIKey | IWHNJTGLUQYRMS-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium?
The IUPAC name of [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium (CID 150622976) is [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium.
What is the SMILES notation for [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium?
The canonical SMILES for [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium is NC(=[NH2+])c1ccc2cc(NC(=O)Cc3cccc(-c4cnoc4)c3)ccc2c1.
What is the InChIKey of [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium?
The InChIKey is IWHNJTGLUQYRMS-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H18N4O2/c23-22(24)18-5-4-17-11-20(7-6-16(17)10-18)26-21(27)9-14-2-1-3-15(8-14)19-12-25-28-13-19/h1-8,10-13H,9H2,(H3,23,24)(H,26,27)/p+1.
What are the key properties of [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium?
[amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium has a molecular weight of 371.42 g/mol, XLogP of 2.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-[6-[[2-[3-(1,2-oxazol-4-yl)phenyl]acetyl]amino]naphthalen-2-yl]methylidene]azanium is sourced from PubChem (CID 150622976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).