C20H15F17O3 — CID 15062345
ethyl 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4-methoxycyclohexa-2,5-dien-1-ylidene]propanoate (PubChem CID 15062345) has the molecular formula C20H15F17O3 and a molecular weight of 626.30 g/mol. Its IUPAC name is ethyl 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4-methoxycyclohexa-2,5-dien-1-ylidene]propanoate.
| Compound Name | ethyl 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4-methoxycyclohexa-2,5-dien-1-ylidene]propanoate |
|---|---|
| PubChem CID | 15062345 |
| Molecular Formula | C20H15F17O3 |
| Molecular Weight | 626.30 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | ethyl 2-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4-methoxycyclohexa-2,5-dien-1-ylidene]propanoate |
| SMILES | CCOC(=O)C(C)=C1C=CC(OC)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C20H15F17O3/c1-4-40-11(38)9(2)10-5-7-12(39-3,8-6-10)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h5-8H,4H2,1-3H3/b10-9- |
| InChIKey | QKLSQRPJFJJUPK-KTKRTIGZSA-N |
| XLogP | 7.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.30 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|