About 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one
3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one (PubChem CID 150624185) has the molecular formula C17H32N2O
and a molecular weight of 280.46 g/mol. Its IUPAC name is 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
Molecular Properties
| Compound Name | 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| PubChem CID | 150624185 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| SMILES | CCC1C(=O)CC2CN(C(C)(C)C)CC1N2C(C)(C)C |
| InChI | InChI=1S/C17H32N2O/c1-8-13-14-11-18(16(2,3)4)10-12(9-15(13)20)19(14)17(5,6)7/h12-14H,8-11H2,1-7H3 |
| InChIKey | IWNNXVCAFRXEFM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The IUPAC name of 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one (CID 150624185) is 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
What is the SMILES notation for 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The canonical SMILES for 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one is CCC1C(=O)CC2CN(C(C)(C)C)CC1N2C(C)(C)C.
What is the InChIKey of 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The InChIKey is IWNNXVCAFRXEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O/c1-8-13-14-11-18(16(2,3)4)10-12(9-15(13)20)19(14)17(5,6)7/h12-14H,8-11H2,1-7H3.
What are the key properties of 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one has a molecular weight of 280.46 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-ditert-butyl-6-ethyl-3,9-diazabicyclo[3.3.1]nonan-7-one is sourced from PubChem (CID 150624185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).