About (5S)-5-methyloxan-3-one
(5S)-5-methyloxan-3-one (PubChem CID 15062435) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is (5S)-5-methyloxan-3-one.
Molecular Properties
| Compound Name | (5S)-5-methyloxan-3-one |
| PubChem CID | 15062435 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (5S)-5-methyloxan-3-one |
| SMILES | C[C@@H]1COCC(=O)C1 |
| InChI | InChI=1S/C6H10O2/c1-5-2-6(7)4-8-3-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | AYSQVLARZJSBRL-YFKPBYRVSA-N |
| XLogP | 0.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-methyloxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyloxan-3-one?
The IUPAC name of (5S)-5-methyloxan-3-one (CID 15062435) is (5S)-5-methyloxan-3-one.
What is the SMILES notation for (5S)-5-methyloxan-3-one?
The canonical SMILES for (5S)-5-methyloxan-3-one is C[C@@H]1COCC(=O)C1.
What is the InChIKey of (5S)-5-methyloxan-3-one?
The InChIKey is AYSQVLARZJSBRL-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10O2/c1-5-2-6(7)4-8-3-5/h5H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of (5S)-5-methyloxan-3-one?
(5S)-5-methyloxan-3-one has a molecular weight of 114.14 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyloxan-3-one is sourced from PubChem (CID 15062435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).