About 1-butoxy-2-fluorobutane
1-butoxy-2-fluorobutane (PubChem CID 15062446) has the molecular formula C8H17FO
and a molecular weight of 148.22 g/mol. Its IUPAC name is 1-butoxy-2-fluorobutane.
Molecular Properties
| Compound Name | 1-butoxy-2-fluorobutane |
| PubChem CID | 15062446 |
| Molecular Formula | C8H17FO |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1-butoxy-2-fluorobutane |
| SMILES | CCCCOCC(F)CC |
| InChI | InChI=1S/C8H17FO/c1-3-5-6-10-7-8(9)4-2/h8H,3-7H2,1-2H3 |
| InChIKey | ZZHXVNNVLNYUDV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-2-fluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-2-fluorobutane?
The IUPAC name of 1-butoxy-2-fluorobutane (CID 15062446) is 1-butoxy-2-fluorobutane.
What is the SMILES notation for 1-butoxy-2-fluorobutane?
The canonical SMILES for 1-butoxy-2-fluorobutane is CCCCOCC(F)CC.
What is the InChIKey of 1-butoxy-2-fluorobutane?
The InChIKey is ZZHXVNNVLNYUDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FO/c1-3-5-6-10-7-8(9)4-2/h8H,3-7H2,1-2H3.
What are the key properties of 1-butoxy-2-fluorobutane?
1-butoxy-2-fluorobutane has a molecular weight of 148.22 g/mol, XLogP of 2.55, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-2-fluorobutane is sourced from PubChem (CID 15062446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).