C9H7NO — CID 15062474
11-oxa-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 15062474) has the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. Its IUPAC name is 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 15062474 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 11-oxa-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | C1=CC2OC1c1cccnc12 |
| InChI | InChI=1S/C9H7NO/c1-2-6-7-3-4-8(11-7)9(6)10-5-1/h1-5,7-8H |
| InChIKey | DNCOFRLRDSGCBS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|