About 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile
6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile (PubChem CID 150627080) has the molecular formula C20H10Cl3N3S
and a molecular weight of 430.75 g/mol. Its IUPAC name is 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile |
| PubChem CID | 150627080 |
| Molecular Formula | C20H10Cl3N3S |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)cc(Sc2cc(Cl)ccc2Cl)c(Cl)c1C#N |
| InChI | InChI=1S/C20H10Cl3N3S/c21-12-6-7-16(22)18(8-12)27-19-9-17(26-13-4-2-1-3-5-13)14(10-24)15(11-25)20(19)23/h1-9,26H |
| InChIKey | IXCQIFBSEIDKKG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile?
The IUPAC name of 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile (CID 150627080) is 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile is N#Cc1c(Nc2ccccc2)cc(Sc2cc(Cl)ccc2Cl)c(Cl)c1C#N.
What is the InChIKey of 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile?
The InChIKey is IXCQIFBSEIDKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl3N3S/c21-12-6-7-16(22)18(8-12)27-19-9-17(26-13-4-2-1-3-5-13)14(10-24)15(11-25)20(19)23/h1-9,26H.
What are the key properties of 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile?
6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile has a molecular weight of 430.75 g/mol, XLogP of 7.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilino-3-chloro-4-(2,5-dichlorophenyl)sulfanylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 150627080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).