C42H40N4O3 — CID 150628097
[4-[[1-[2-[(4-hydroxyphenyl)diazenyl]naphthalen-1-yl]naphthalen-2-yl]diazenyl]phenyl] decanoate (PubChem CID 150628097) has the molecular formula C42H40N4O3 and a molecular weight of 648.81 g/mol. Its IUPAC name is [4-[[1-[2-[(4-hydroxyphenyl)diazenyl]naphthalen-1-yl]naphthalen-2-yl]diazenyl]phenyl] decanoate.
| Compound Name | [4-[[1-[2-[(4-hydroxyphenyl)diazenyl]naphthalen-1-yl]naphthalen-2-yl]diazenyl]phenyl] decanoate |
|---|---|
| PubChem CID | 150628097 |
| Molecular Formula | C42H40N4O3 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | [4-[[1-[2-[(4-hydroxyphenyl)diazenyl]naphthalen-1-yl]naphthalen-2-yl]diazenyl]phenyl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(/N=N/c2ccc3ccccc3c2-c2c(/N=N/c3ccc(O)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C42H40N4O3/c1-2-3-4-5-6-7-8-17-40(48)49-35-26-22-33(23-27-35)44-46-39-29-19-31-14-10-12-16-37(31)42(39)41-36-15-11-9-13-30(36)18-28-38(41)45-43-32-20-24-34(47)25-21-32/h9-16,18-29,47H,2-8,17H2,1H3/b45-43+,46-44+ |
| InChIKey | IXHQZFNCCXQBGW-MWOVFPFUSA-N |
| XLogP | 13.24 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|