About 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine
7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine (PubChem CID 150629106) has the molecular formula C10H11FN2
and a molecular weight of 178.21 g/mol. Its IUPAC name is 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine |
| PubChem CID | 150629106 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine |
| SMILES | CN1C=c2cc(F)ccc2=NCC1 |
| InChI | InChI=1S/C10H11FN2/c1-13-5-4-12-10-3-2-9(11)6-8(10)7-13/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | IXMTWLGRIHKLOT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine?
The IUPAC name of 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine (CID 150629106) is 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine.
What is the SMILES notation for 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine?
The canonical SMILES for 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine is CN1C=c2cc(F)ccc2=NCC1.
What is the InChIKey of 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine?
The InChIKey is IXMTWLGRIHKLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2/c1-13-5-4-12-10-3-2-9(11)6-8(10)7-13/h2-3,6-7H,4-5H2,1H3.
What are the key properties of 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine?
7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine has a molecular weight of 178.21 g/mol, XLogP of 0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methyl-2,3-dihydro-1,4-benzodiazepine is sourced from PubChem (CID 150629106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).