C16H34O2Si — CID 15063086
(4S,6R)-5-methyl-2,2,4,6-tetra(propan-2-yl)-1,3,2-dioxasilinane (PubChem CID 15063086) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (4S,6R)-5-methyl-2,2,4,6-tetra(propan-2-yl)-1,3,2-dioxasilinane.
| Compound Name | (4S,6R)-5-methyl-2,2,4,6-tetra(propan-2-yl)-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 15063086 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (4S,6R)-5-methyl-2,2,4,6-tetra(propan-2-yl)-1,3,2-dioxasilinane |
| SMILES | CC(C)[C@H]1O[Si](C(C)C)(C(C)C)O[C@@H](C(C)C)C1C |
| InChI | InChI=1S/C16H34O2Si/c1-10(2)15-14(9)16(11(3)4)18-19(17-15,12(5)6)13(7)8/h10-16H,1-9H3/t14?,15-,16+ |
| InChIKey | OKSKILHKCGTPOT-MQVJKMGUSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|