About 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one
2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one (PubChem CID 15063235) has the molecular formula C13H20N4OS
and a molecular weight of 280.40 g/mol. Its IUPAC name is 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one.
Molecular Properties
| Compound Name | 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one |
| PubChem CID | 15063235 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one |
| SMILES | O=c1nc(N2CCCCC2)sc(N2CCCCC2)n1 |
| InChI | InChI=1S/C13H20N4OS/c18-11-14-12(16-7-3-1-4-8-16)19-13(15-11)17-9-5-2-6-10-17/h1-10H2 |
| InChIKey | YZFVDEXURLQWTM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one?
The IUPAC name of 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one (CID 15063235) is 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one.
What is the SMILES notation for 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one?
The canonical SMILES for 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one is O=c1nc(N2CCCCC2)sc(N2CCCCC2)n1.
What is the InChIKey of 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one?
The InChIKey is YZFVDEXURLQWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4OS/c18-11-14-12(16-7-3-1-4-8-16)19-13(15-11)17-9-5-2-6-10-17/h1-10H2.
What are the key properties of 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one?
2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one has a molecular weight of 280.40 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(piperidin-1-yl)-1,3,5-thiadiazin-4-one is sourced from PubChem (CID 15063235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).