About 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one
8,9-dihydro-6H-pyrido[1,2-a]indol-7-one (PubChem CID 15063399) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one.
Molecular Properties
| Compound Name | 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one |
| PubChem CID | 15063399 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one |
| SMILES | O=C1CCc2cc3ccccc3n2C1 |
| InChI | InChI=1S/C12H11NO/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-4,7H,5-6,8H2 |
| InChIKey | PQHGPIHLRAAIDG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one?
The IUPAC name of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one (CID 15063399) is 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one.
What is the SMILES notation for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one?
The canonical SMILES for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one is O=C1CCc2cc3ccccc3n2C1.
What is the InChIKey of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one?
The InChIKey is PQHGPIHLRAAIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-4,7H,5-6,8H2.
What are the key properties of 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one?
8,9-dihydro-6H-pyrido[1,2-a]indol-7-one has a molecular weight of 185.23 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-6H-pyrido[1,2-a]indol-7-one is sourced from PubChem (CID 15063399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).