C11H14FNO2S — CID 150635533
(S)-N-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 150635533) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is (S)-N-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 150635533 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (S)-N-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N=Cc1cc(F)ccc1O |
| InChI | InChI=1S/C11H14FNO2S/c1-11(2,3)16(15)13-7-8-6-9(12)4-5-10(8)14/h4-7,14H,1-3H3/t16-/m0/s1 |
| InChIKey | IYUMXARIKSQOJR-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|