C22H29N5O3Si — CID 150636162
[3-[6-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]-2-pyridinyl]-1H-pyrrolo[2,3-c]pyridin-5-yl]urea (PubChem CID 150636162) has the molecular formula C22H29N5O3Si and a molecular weight of 439.59 g/mol. Its IUPAC name is [3-[6-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]-2-pyridinyl]-1H-pyrrolo[2,3-c]pyridin-5-yl]urea.
| Compound Name | [3-[6-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]-2-pyridinyl]-1H-pyrrolo[2,3-c]pyridin-5-yl]urea |
|---|---|
| PubChem CID | 150636162 |
| Molecular Formula | C22H29N5O3Si |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [3-[6-[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]-2-pyridinyl]-1H-pyrrolo[2,3-c]pyridin-5-yl]urea |
| SMILES | CC(C)(C)[Si](C)(C)OC1(c2cccc(-c3c[nH]c4cnc(NC(N)=O)cc34)n2)COC1 |
| InChI | InChI=1S/C22H29N5O3Si/c1-21(2,3)31(4,5)30-22(12-29-13-22)18-8-6-7-16(26-18)15-10-24-17-11-25-19(9-14(15)17)27-20(23)28/h6-11,24H,12-13H2,1-5H3,(H3,23,25,27,28) |
| InChIKey | IYXXVCYGQCEQRP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|