C7H2F7N — CID 15063668
2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethyl)pyridine (PubChem CID 15063668) has the molecular formula C7H2F7N and a molecular weight of 233.09 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethyl)pyridine |
|---|---|
| PubChem CID | 15063668 |
| Molecular Formula | C7H2F7N |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethyl)pyridine |
| SMILES | Fc1nc(F)c(F)c(CC(F)(F)F)c1F |
| InChI | InChI=1S/C7H2F7N/c8-3-2(1-7(12,13)14)4(9)6(11)15-5(3)10/h1H2 |
| InChIKey | OKDXKZVVYBXZIC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|