C17H15FN2O4S — CID 150637759
6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-1,2-dihydro-3,1-benzoxazine-2-sulfonic acid (PubChem CID 150637759) has the molecular formula C17H15FN2O4S and a molecular weight of 362.38 g/mol. Its IUPAC name is 6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-1,2-dihydro-3,1-benzoxazine-2-sulfonic acid.
| Compound Name | 6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-1,2-dihydro-3,1-benzoxazine-2-sulfonic acid |
|---|---|
| PubChem CID | 150637759 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-1,2-dihydro-3,1-benzoxazine-2-sulfonic acid |
| SMILES | CC1(C)OC(S(=O)(=O)O)Nc2ccc(-c3cc(F)cc(C#N)c3)cc21 |
| InChI | InChI=1S/C17H15FN2O4S/c1-17(2)14-8-11(12-5-10(9-19)6-13(18)7-12)3-4-15(14)20-16(24-17)25(21,22)23/h3-8,16,20H,1-2H3,(H,21,22,23) |
| InChIKey | IZGFOPJGILGMRF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|