C11H18N2O7S3 — CID 150641840
2-(butylsulfonylamino)-3-(methanesulfonamido)benzenesulfonic acid (PubChem CID 150641840) has the molecular formula C11H18N2O7S3 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-3-(methanesulfonamido)benzenesulfonic acid.
| Compound Name | 2-(butylsulfonylamino)-3-(methanesulfonamido)benzenesulfonic acid |
|---|---|
| PubChem CID | 150641840 |
| Molecular Formula | C11H18N2O7S3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-(butylsulfonylamino)-3-(methanesulfonamido)benzenesulfonic acid |
| SMILES | CCCCS(=O)(=O)Nc1c(NS(C)(=O)=O)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C11H18N2O7S3/c1-3-4-8-22(16,17)13-11-9(12-21(2,14)15)6-5-7-10(11)23(18,19)20/h5-7,12-13H,3-4,8H2,1-2H3,(H,18,19,20) |
| InChIKey | JABQMVYYZDOEGP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|