C28H21IN2OS2 — CID 15064311
[3-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]pyrrolo[2,1-b][1,3]benzothiazol-1-yl]-phenylmethanone iodide (PubChem CID 15064311) has the molecular formula C28H21IN2OS2 and a molecular weight of 592.53 g/mol. Its IUPAC name is [3-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]pyrrolo[2,1-b][1,3]benzothiazol-1-yl]-phenylmethanone iodide.
| Compound Name | [3-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]pyrrolo[2,1-b][1,3]benzothiazol-1-yl]-phenylmethanone iodide |
|---|---|
| PubChem CID | 15064311 |
| Molecular Formula | C28H21IN2OS2 |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 592.01 |
| IUPAC Name | [3-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]pyrrolo[2,1-b][1,3]benzothiazol-1-yl]-phenylmethanone iodide |
| SMILES | CC[n+]1c(/C=C/c2cc(C(=O)c3ccccc3)n3c2sc2ccccc23)sc2ccccc21.[I-] |
| InChI | InChI=1S/C28H21N2OS2.HI/c1-2-29-21-12-6-8-14-24(21)32-26(29)17-16-20-18-23(27(31)19-10-4-3-5-11-19)30-22-13-7-9-15-25(22)33-28(20)30;/h3-18H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | FPAWMRZVMUZWMM-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|