C12H15Cl2N3O — CID 150643193
(4S)-4-[[2-(3,5-dichlorophenyl)ethylamino]methyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 150643193) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is (4S)-4-[[2-(3,5-dichlorophenyl)ethylamino]methyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[[2-(3,5-dichlorophenyl)ethylamino]methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 150643193 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (4S)-4-[[2-(3,5-dichlorophenyl)ethylamino]methyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@H](CNCCc2cc(Cl)cc(Cl)c2)CO1 |
| InChI | InChI=1S/C12H15Cl2N3O/c13-9-3-8(4-10(14)5-9)1-2-16-6-11-7-18-12(15)17-11/h3-5,11,16H,1-2,6-7H2,(H2,15,17)/t11-/m0/s1 |
| InChIKey | JAINELKEOUIJIB-NSHDSACASA-N |
| XLogP | 1.84 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|