C32H27NO2 — CID 15064438
4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-2,6-diphenylpyridine (PubChem CID 15064438) has the molecular formula C32H27NO2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-2,6-diphenylpyridine.
| Compound Name | 4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 15064438 |
| Molecular Formula | C32H27NO2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-[(4-methoxyphenyl)methyl]-2,6-diphenylpyridine |
| SMILES | COc1ccc(Cc2c(-c3ccc(OC)cc3)cc(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H27NO2/c1-34-27-17-13-23(14-18-27)21-30-29(24-15-19-28(35-2)20-16-24)22-31(25-9-5-3-6-10-25)33-32(30)26-11-7-4-8-12-26/h3-20,22H,21H2,1-2H3 |
| InChIKey | SBTLLDNCHIZLDB-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |