C12ClF9O3S — CID 15064544
(4-chloro-2,3,5,6-tetrafluorophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 15064544) has the molecular formula C12ClF9O3S and a molecular weight of 430.63 g/mol. Its IUPAC name is (4-chloro-2,3,5,6-tetrafluorophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (4-chloro-2,3,5,6-tetrafluorophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 15064544 |
| Molecular Formula | C12ClF9O3S |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | (4-chloro-2,3,5,6-tetrafluorophenyl) 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(Cl)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12ClF9O3S/c13-1-2(14)7(19)11(8(20)3(1)15)25-26(23,24)12-9(21)5(17)4(16)6(18)10(12)22 |
| InChIKey | CQCJOTRTXHKXJF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|