C6F5O2S- — CID 15064561
2,3,4,5,6-pentafluorobenzenesulfinate (PubChem CID 15064561) has the molecular formula C6F5O2S- and a molecular weight of 231.12 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenesulfinate.
| Compound Name | 2,3,4,5,6-pentafluorobenzenesulfinate |
|---|---|
| PubChem CID | 15064561 |
| Molecular Formula | C6F5O2S- |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfinate |
| SMILES | O=S([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5O2S/c7-1-2(8)4(10)6(14(12)13)5(11)3(1)9/h(H,12,13)/p-1 |
| InChIKey | WXTAHNGYXUGGTE-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|