C8H14O3S — CID 15064747
(4R,4aS,7aS)-1,1-dioxo-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-4-ol (PubChem CID 15064747) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is (4R,4aS,7aS)-1,1-dioxo-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-4-ol.
| Compound Name | (4R,4aS,7aS)-1,1-dioxo-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-4-ol |
|---|---|
| PubChem CID | 15064747 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (4R,4aS,7aS)-1,1-dioxo-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-4-ol |
| SMILES | O=S1(=O)CC[C@@H](O)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C8H14O3S/c9-7-4-5-12(10,11)8-3-1-2-6(7)8/h6-9H,1-5H2/t6-,7+,8-/m0/s1 |
| InChIKey | QHLQGECPJDNMAJ-RNJXMRFFSA-N |
| XLogP | 0.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |