About methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate
methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 150648476) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 150648476 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n1 |
| InChI | InChI=1S/C19H25NO4/c1-18(2,3)11-8-12(15(21)13(9-11)19(4,5)6)16-20-14(10-24-16)17(22)23-7/h8-10,21H,1-7H3 |
| InChIKey | JBJKHBJPLRAQLT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate (CID 150648476) is methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate is COC(=O)c1coc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n1.
What is the InChIKey of methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate?
The InChIKey is JBJKHBJPLRAQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4/c1-18(2,3)11-8-12(15(21)13(9-11)19(4,5)6)16-20-14(10-24-16)17(22)23-7/h8-10,21H,1-7H3.
What are the key properties of methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate?
methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate has a molecular weight of 331.41 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,5-ditert-butyl-2-hydroxyphenyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 150648476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).