About 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 150649257) has the molecular formula C13H20F3N
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 150649257 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC1=C(C(F)(F)F)C=CC(N)(CCC)C1 |
| InChI | InChI=1S/C13H20F3N/c1-3-5-10-9-12(17,7-4-2)8-6-11(10)13(14,15)16/h6,8H,3-5,7,9,17H2,1-2H3 |
| InChIKey | JBNKJBRUGGMKCS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 150649257) is 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is CCCC1=C(C(F)(F)F)C=CC(N)(CCC)C1.
What is the InChIKey of 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is JBNKJBRUGGMKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N/c1-3-5-10-9-12(17,7-4-2)8-6-11(10)13(14,15)16/h6,8H,3-5,7,9,17H2,1-2H3.
What are the key properties of 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 247.30 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dipropyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 150649257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).