C9H13N3O2 — CID 150650176
3-(5-amino-2-pyridinyl)propylcarbamic acid (PubChem CID 150650176) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(5-amino-2-pyridinyl)propylcarbamic acid.
| Compound Name | 3-(5-amino-2-pyridinyl)propylcarbamic acid |
|---|---|
| PubChem CID | 150650176 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(5-amino-2-pyridinyl)propylcarbamic acid |
| SMILES | Nc1ccc(CCCNC(=O)O)nc1 |
| InChI | InChI=1S/C9H13N3O2/c10-7-3-4-8(12-6-7)2-1-5-11-9(13)14/h3-4,6,11H,1-2,5,10H2,(H,13,14) |
| InChIKey | JBRZHKIYCJOPBY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|