About 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide
5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 15065230) has the molecular formula C17H12Cl2IN5O2
and a molecular weight of 516.13 g/mol. Its IUPAC name is 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide |
| PubChem CID | 15065230 |
| Molecular Formula | C17H12Cl2IN5O2 |
| Molecular Weight | 516.13 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(I)cc3)c(Cl)c2)c1N |
| InChI | InChI=1S/C17H12Cl2IN5O2/c18-11-5-8(7-25-16(21)14(17(22)27)23-24-25)6-12(19)13(11)15(26)9-1-3-10(20)4-2-9/h1-6H,7,21H2,(H2,22,27) |
| InChIKey | LXPXOYNUTGFXLE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide?
The IUPAC name of 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide (CID 15065230) is 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide.
What is the SMILES notation for 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide?
The canonical SMILES for 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide is NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(I)cc3)c(Cl)c2)c1N.
What is the InChIKey of 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide?
The InChIKey is LXPXOYNUTGFXLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2IN5O2/c18-11-5-8(7-25-16(21)14(17(22)27)23-24-25)6-12(19)13(11)15(26)9-1-3-10(20)4-2-9/h1-6H,7,21H2,(H2,22,27).
What are the key properties of 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide?
5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide has a molecular weight of 516.13 g/mol, XLogP of 3.15, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-[[3,5-dichloro-4-(4-iodobenzoyl)phenyl]methyl]triazole-4-carboxamide is sourced from PubChem (CID 15065230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).