C10H9N3S — CID 15065266
4,5-dihydro-[1,3]thiazolo[4,5-f]isoquinolin-2-amine (PubChem CID 15065266) has the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. Its IUPAC name is 4,5-dihydro-[1,3]thiazolo[4,5-f]isoquinolin-2-amine.
| Compound Name | 4,5-dihydro-[1,3]thiazolo[4,5-f]isoquinolin-2-amine |
|---|---|
| PubChem CID | 15065266 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 4,5-dihydro-[1,3]thiazolo[4,5-f]isoquinolin-2-amine |
| SMILES | Nc1nc2c(s1)CCc1cnccc1-2 |
| InChI | InChI=1S/C10H9N3S/c11-10-13-9-7-3-4-12-5-6(7)1-2-8(9)14-10/h3-5H,1-2H2,(H2,11,13) |
| InChIKey | BFJJPNVORUMDJK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |