About 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine
2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine (PubChem CID 150655734) has the molecular formula C30H55FN2O2
and a molecular weight of 494.78 g/mol. Its IUPAC name is 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine.
Molecular Properties
| Compound Name | 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine |
| PubChem CID | 150655734 |
| Molecular Formula | C30H55FN2O2 |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 494.42 |
| IUPAC Name | 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine |
| SMILES | CC(C)(C)CCCCCCCCCOc1ncc(F)c(OCCCCCCCCCC(C)(C)C)n1 |
| InChI | InChI=1S/C30H55FN2O2/c1-29(2,3)21-17-13-9-7-11-15-19-23-34-27-26(31)25-32-28(33-27)35-24-20-16-12-8-10-14-18-22-30(4,5)6/h25H,7-24H2,1-6H3 |
| InChIKey | JCUUXFPMUNBRCT-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine?
The IUPAC name of 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine (CID 150655734) is 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine.
What is the SMILES notation for 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine?
The canonical SMILES for 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine is CC(C)(C)CCCCCCCCCOc1ncc(F)c(OCCCCCCCCCC(C)(C)C)n1.
What is the InChIKey of 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine?
The InChIKey is JCUUXFPMUNBRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H55FN2O2/c1-29(2,3)21-17-13-9-7-11-15-19-23-34-27-26(31)25-32-28(33-27)35-24-20-16-12-8-10-14-18-22-30(4,5)6/h25H,7-24H2,1-6H3.
What are the key properties of 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine?
2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine has a molecular weight of 494.78 g/mol, XLogP of 9.71, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(10,10-dimethylundecoxy)-5-fluoropyrimidine is sourced from PubChem (CID 150655734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).