C10H12N4O — CID 15065575
1-(4-imidazol-1-ylbut-2-ynyl)imidazolidin-2-one (PubChem CID 15065575) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(4-imidazol-1-ylbut-2-ynyl)imidazolidin-2-one.
| Compound Name | 1-(4-imidazol-1-ylbut-2-ynyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 15065575 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(4-imidazol-1-ylbut-2-ynyl)imidazolidin-2-one |
| SMILES | O=C1NCCN1CC#CCn1ccnc1 |
| InChI | InChI=1S/C10H12N4O/c15-10-12-4-8-14(10)6-2-1-5-13-7-3-11-9-13/h3,7,9H,4-6,8H2,(H,12,15) |
| InChIKey | KMYRTHOJNCIAHR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|